About 3,4-dimethyl-1-(4-methyl-3-pyridinyl)imidazo[1,5-a]quinoxaline
3,4-dimethyl-1-(4-methyl-3-pyridinyl)imidazo[1,5-a]quinoxaline (PubChem CID 56648764) has the molecular formula C18H16N4
and a molecular weight of 288.35 g/mol. Its IUPAC name is 3,4-dimethyl-1-(4-methyl-3-pyridinyl)imidazo[1,5-a]quinoxaline.
Molecular Properties
| Compound Name | 3,4-dimethyl-1-(4-methyl-3-pyridinyl)imidazo[1,5-a]quinoxaline |
| PubChem CID | 56648764 |
| Molecular Formula | C18H16N4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3,4-dimethyl-1-(4-methyl-3-pyridinyl)imidazo[1,5-a]quinoxaline |
| SMILES | Cc1ccncc1-c1nc(C)c2c(C)nc3ccccc3n12 |
| InChI | InChI=1S/C18H16N4/c1-11-8-9-19-10-14(11)18-21-13(3)17-12(2)20-15-6-4-5-7-16(15)22(17)18/h4-10H,1-3H3 |
| InChIKey | PYGVXOGEKPDRFE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,4-dimethyl-1-(4-methyl-3-pyridinyl)imidazo[1,5-a]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-1-(4-methyl-3-pyridinyl)imidazo[1,5-a]quinoxaline?
The IUPAC name of 3,4-dimethyl-1-(4-methyl-3-pyridinyl)imidazo[1,5-a]quinoxaline (CID 56648764) is 3,4-dimethyl-1-(4-methyl-3-pyridinyl)imidazo[1,5-a]quinoxaline.
What is the SMILES notation for 3,4-dimethyl-1-(4-methyl-3-pyridinyl)imidazo[1,5-a]quinoxaline?
The canonical SMILES for 3,4-dimethyl-1-(4-methyl-3-pyridinyl)imidazo[1,5-a]quinoxaline is Cc1ccncc1-c1nc(C)c2c(C)nc3ccccc3n12.
What is the InChIKey of 3,4-dimethyl-1-(4-methyl-3-pyridinyl)imidazo[1,5-a]quinoxaline?
The InChIKey is PYGVXOGEKPDRFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4/c1-11-8-9-19-10-14(11)18-21-13(3)17-12(2)20-15-6-4-5-7-16(15)22(17)18/h4-10H,1-3H3.
What are the key properties of 3,4-dimethyl-1-(4-methyl-3-pyridinyl)imidazo[1,5-a]quinoxaline?
3,4-dimethyl-1-(4-methyl-3-pyridinyl)imidazo[1,5-a]quinoxaline has a molecular weight of 288.35 g/mol, XLogP of 3.87, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-1-(4-methyl-3-pyridinyl)imidazo[1,5-a]quinoxaline is sourced from PubChem (CID 56648764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).