About 2-phenyl-5,6-bis(phenylmethoxy)-7-prop-2-enoxychromen-4-one
2-phenyl-5,6-bis(phenylmethoxy)-7-prop-2-enoxychromen-4-one (PubChem CID 56649004) has the molecular formula C32H26O5
and a molecular weight of 490.56 g/mol. Its IUPAC name is 2-phenyl-5,6-bis(phenylmethoxy)-7-prop-2-enoxychromen-4-one.
Molecular Properties
| Compound Name | 2-phenyl-5,6-bis(phenylmethoxy)-7-prop-2-enoxychromen-4-one |
| PubChem CID | 56649004 |
| Molecular Formula | C32H26O5 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 2-phenyl-5,6-bis(phenylmethoxy)-7-prop-2-enoxychromen-4-one |
| SMILES | C=CCOc1cc2oc(-c3ccccc3)cc(=O)c2c(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C32H26O5/c1-2-18-34-29-20-28-30(26(33)19-27(37-28)25-16-10-5-11-17-25)32(36-22-24-14-8-4-9-15-24)31(29)35-21-23-12-6-3-7-13-23/h2-17,19-20H,1,18,21-22H2 |
| InChIKey | VXGVZHVFUJGHJP-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-5,6-bis(phenylmethoxy)-7-prop-2-enoxychromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-5,6-bis(phenylmethoxy)-7-prop-2-enoxychromen-4-one?
The IUPAC name of 2-phenyl-5,6-bis(phenylmethoxy)-7-prop-2-enoxychromen-4-one (CID 56649004) is 2-phenyl-5,6-bis(phenylmethoxy)-7-prop-2-enoxychromen-4-one.
What is the SMILES notation for 2-phenyl-5,6-bis(phenylmethoxy)-7-prop-2-enoxychromen-4-one?
The canonical SMILES for 2-phenyl-5,6-bis(phenylmethoxy)-7-prop-2-enoxychromen-4-one is C=CCOc1cc2oc(-c3ccccc3)cc(=O)c2c(OCc2ccccc2)c1OCc1ccccc1.
What is the InChIKey of 2-phenyl-5,6-bis(phenylmethoxy)-7-prop-2-enoxychromen-4-one?
The InChIKey is VXGVZHVFUJGHJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H26O5/c1-2-18-34-29-20-28-30(26(33)19-27(37-28)25-16-10-5-11-17-25)32(36-22-24-14-8-4-9-15-24)31(29)35-21-23-12-6-3-7-13-23/h2-17,19-20H,1,18,21-22H2.
What are the key properties of 2-phenyl-5,6-bis(phenylmethoxy)-7-prop-2-enoxychromen-4-one?
2-phenyl-5,6-bis(phenylmethoxy)-7-prop-2-enoxychromen-4-one has a molecular weight of 490.56 g/mol, XLogP of 7.18, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-5,6-bis(phenylmethoxy)-7-prop-2-enoxychromen-4-one is sourced from PubChem (CID 56649004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).