About N-[4-(aminomethyl)-1,3-thiazol-2-yl]-1,2-oxazole-3-carboxamide
N-[4-(aminomethyl)-1,3-thiazol-2-yl]-1,2-oxazole-3-carboxamide (PubChem CID 56649138) has the molecular formula C8H8N4O2S
and a molecular weight of 224.25 g/mol. Its IUPAC name is N-[4-(aminomethyl)-1,3-thiazol-2-yl]-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[4-(aminomethyl)-1,3-thiazol-2-yl]-1,2-oxazole-3-carboxamide |
| PubChem CID | 56649138 |
| Molecular Formula | C8H8N4O2S |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | N-[4-(aminomethyl)-1,3-thiazol-2-yl]-1,2-oxazole-3-carboxamide |
| SMILES | NCc1csc(NC(=O)c2ccon2)n1 |
| InChI | InChI=1S/C8H8N4O2S/c9-3-5-4-15-8(10-5)11-7(13)6-1-2-14-12-6/h1-2,4H,3,9H2,(H,10,11,13) |
| InChIKey | MMGISVMNCYFAQS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-(aminomethyl)-1,3-thiazol-2-yl]-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(aminomethyl)-1,3-thiazol-2-yl]-1,2-oxazole-3-carboxamide?
The IUPAC name of N-[4-(aminomethyl)-1,3-thiazol-2-yl]-1,2-oxazole-3-carboxamide (CID 56649138) is N-[4-(aminomethyl)-1,3-thiazol-2-yl]-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-[4-(aminomethyl)-1,3-thiazol-2-yl]-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-[4-(aminomethyl)-1,3-thiazol-2-yl]-1,2-oxazole-3-carboxamide is NCc1csc(NC(=O)c2ccon2)n1.
What is the InChIKey of N-[4-(aminomethyl)-1,3-thiazol-2-yl]-1,2-oxazole-3-carboxamide?
The InChIKey is MMGISVMNCYFAQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O2S/c9-3-5-4-15-8(10-5)11-7(13)6-1-2-14-12-6/h1-2,4H,3,9H2,(H,10,11,13).
What are the key properties of N-[4-(aminomethyl)-1,3-thiazol-2-yl]-1,2-oxazole-3-carboxamide?
N-[4-(aminomethyl)-1,3-thiazol-2-yl]-1,2-oxazole-3-carboxamide has a molecular weight of 224.25 g/mol, XLogP of 0.84, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(aminomethyl)-1,3-thiazol-2-yl]-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 56649138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).