C24H34O6 — CID 56649368
(1S,5R,8Z,10E,13S,14E,16Z,19S,21R,22E,24S)-13,19,21-trihydroxy-5-methyl-6,25-dioxabicyclo[22.1.0]pentacosa-8,10,14,16,22-pentaen-7-one (PubChem CID 56649368) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is (1S,5R,8Z,10E,13S,14E,16Z,19S,21R,22E,24S)-13,19,21-trihydroxy-5-methyl-6,25-dioxabicyclo[22.1.0]pentacosa-8,10,14,16,22-pentaen-7-one.
| Compound Name | (1S,5R,8Z,10E,13S,14E,16Z,19S,21R,22E,24S)-13,19,21-trihydroxy-5-methyl-6,25-dioxabicyclo[22.1.0]pentacosa-8,10,14,16,22-pentaen-7-one |
|---|---|
| PubChem CID | 56649368 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (1S,5R,8Z,10E,13S,14E,16Z,19S,21R,22E,24S)-13,19,21-trihydroxy-5-methyl-6,25-dioxabicyclo[22.1.0]pentacosa-8,10,14,16,22-pentaen-7-one |
| SMILES | C[C@@H]1CCC[C@@H]2O[C@H]2/C=C/[C@H](O)C[C@@H](O)C/C=C\C=C\[C@@H](O)C/C=C/C=C\C(=O)O1 |
| InChI | InChI=1S/C24H34O6/c1-18-9-8-13-22-23(30-22)16-15-21(27)17-20(26)12-6-2-4-10-19(25)11-5-3-7-14-24(28)29-18/h2-7,10,14-16,18-23,25-27H,8-9,11-13,17H2,1H3/b5-3+,6-2-,10-4+,14-7-,16-15+/t18-,19-,20+,21+,22+,23+/m1/s1 |
| InChIKey | CZLKSWQTORVBNM-VFDZIYPSSA-N |
| XLogP | 2.90 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|