C22H27F2IN2O3 — CID 56649554
tert-butyl N-[(2S,3R)-1,1-difluoro-3-hydroxy-4-[(3-iodophenyl)methylamino]-1-phenylbutan-2-yl]carbamate (PubChem CID 56649554) has the molecular formula C22H27F2IN2O3 and a molecular weight of 532.37 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-1,1-difluoro-3-hydroxy-4-[(3-iodophenyl)methylamino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-1,1-difluoro-3-hydroxy-4-[(3-iodophenyl)methylamino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 56649554 |
| Molecular Formula | C22H27F2IN2O3 |
| Molecular Weight | 532.37 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | tert-butyl N-[(2S,3R)-1,1-difluoro-3-hydroxy-4-[(3-iodophenyl)methylamino]-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]([C@H](O)CNCc1cccc(I)c1)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C22H27F2IN2O3/c1-21(2,3)30-20(29)27-19(22(23,24)16-9-5-4-6-10-16)18(28)14-26-13-15-8-7-11-17(25)12-15/h4-12,18-19,26,28H,13-14H2,1-3H3,(H,27,29)/t18-,19+/m1/s1 |
| InChIKey | YXANYQVMPJTGLK-MOPGFXCFSA-N |
| XLogP | 4.43 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|