C24H20N6O3S — CID 56649602
2-hydroxy-N-[2-[[4-[6-(3-hydroxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzamide (PubChem CID 56649602) has the molecular formula C24H20N6O3S and a molecular weight of 472.53 g/mol. Its IUPAC name is 2-hydroxy-N-[2-[[4-[6-(3-hydroxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzamide.
| Compound Name | 2-hydroxy-N-[2-[[4-[6-(3-hydroxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 56649602 |
| Molecular Formula | C24H20N6O3S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 2-hydroxy-N-[2-[[4-[6-(3-hydroxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]benzamide |
| SMILES | O=C(NCCNc1nccc(-c2c(-c3cccc(O)c3)nc3sccn23)n1)c1ccccc1O |
| InChI | InChI=1S/C24H20N6O3S/c31-16-5-3-4-15(14-16)20-21(30-12-13-34-24(30)29-20)18-8-9-26-23(28-18)27-11-10-25-22(33)17-6-1-2-7-19(17)32/h1-9,12-14,31-32H,10-11H2,(H,25,33)(H,26,27,28) |
| InChIKey | PPHVDJJPJBPBIE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 124.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|