C12H7F5O3S — CID 56649919
1-(1-benzothiophen-3-yl)-2,2,4,4,4-pentafluoro-3,3-dihydroxybutan-1-one (PubChem CID 56649919) has the molecular formula C12H7F5O3S and a molecular weight of 326.24 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-2,2,4,4,4-pentafluoro-3,3-dihydroxybutan-1-one.
| Compound Name | 1-(1-benzothiophen-3-yl)-2,2,4,4,4-pentafluoro-3,3-dihydroxybutan-1-one |
|---|---|
| PubChem CID | 56649919 |
| Molecular Formula | C12H7F5O3S |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-2,2,4,4,4-pentafluoro-3,3-dihydroxybutan-1-one |
| SMILES | O=C(c1csc2ccccc12)C(F)(F)C(O)(O)C(F)(F)F |
| InChI | InChI=1S/C12H7F5O3S/c13-10(14,11(19,20)12(15,16)17)9(18)7-5-21-8-4-2-1-3-6(7)8/h1-5,19-20H |
| InChIKey | UHKXGTAWMPDXOD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|