C28H46O8Si — CID 56649929
3-methylbut-2-enyl (5R)-2-[2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetyl]-3-oxo-5-tri(propan-2-yl)silyloxyhexanoate (PubChem CID 56649929) has the molecular formula C28H46O8Si and a molecular weight of 538.75 g/mol. Its IUPAC name is 3-methylbut-2-enyl (5R)-2-[2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetyl]-3-oxo-5-tri(propan-2-yl)silyloxyhexanoate.
| Compound Name | 3-methylbut-2-enyl (5R)-2-[2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetyl]-3-oxo-5-tri(propan-2-yl)silyloxyhexanoate |
|---|---|
| PubChem CID | 56649929 |
| Molecular Formula | C28H46O8Si |
| Molecular Weight | 538.75 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | 3-methylbut-2-enyl (5R)-2-[2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetyl]-3-oxo-5-tri(propan-2-yl)silyloxyhexanoate |
| SMILES | CC(C)=CCOC(=O)C(C(=O)CC1=CC(=O)OC(C)(C)O1)C(=O)C[C@@H](C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H46O8Si/c1-17(2)12-13-33-27(32)26(24(30)15-22-16-25(31)35-28(10,11)34-22)23(29)14-21(9)36-37(18(3)4,19(5)6)20(7)8/h12,16,18-21,26H,13-15H2,1-11H3/t21-,26?/m1/s1 |
| InChIKey | RZFOASZJZZGPLQ-OSMGYRLQSA-N |
| XLogP | 5.80 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.75 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|