C27H46O6Si — CID 56649931
(2R)-7-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-8,8-dimethyl-2-tri(propan-2-yl)silyloxydec-9-ene-4,6-dione (PubChem CID 56649931) has the molecular formula C27H46O6Si and a molecular weight of 494.75 g/mol. Its IUPAC name is (2R)-7-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-8,8-dimethyl-2-tri(propan-2-yl)silyloxydec-9-ene-4,6-dione.
| Compound Name | (2R)-7-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-8,8-dimethyl-2-tri(propan-2-yl)silyloxydec-9-ene-4,6-dione |
|---|---|
| PubChem CID | 56649931 |
| Molecular Formula | C27H46O6Si |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | (2R)-7-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-8,8-dimethyl-2-tri(propan-2-yl)silyloxydec-9-ene-4,6-dione |
| SMILES | C=CC(C)(C)C(C(=O)CC(=O)C[C@@H](C)O[Si](C(C)C)(C(C)C)C(C)C)C1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C27H46O6Si/c1-13-26(9,10)25(23-16-24(30)32-27(11,12)31-23)22(29)15-21(28)14-20(8)33-34(17(2)3,18(4)5)19(6)7/h13,16-20,25H,1,14-15H2,2-12H3/t20-,25?/m1/s1 |
| InChIKey | QJLLSOFURQGSMD-VGOKPJQXSA-N |
| XLogP | 6.51 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|