C14H12ClNO4 — CID 56650404
2-(4-chloro-2-nitrophenyl)-1,3-dimethoxybenzene (PubChem CID 56650404) has the molecular formula C14H12ClNO4 and a molecular weight of 293.71 g/mol. Its IUPAC name is 2-(4-chloro-2-nitrophenyl)-1,3-dimethoxybenzene.
| Compound Name | 2-(4-chloro-2-nitrophenyl)-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 56650404 |
| Molecular Formula | C14H12ClNO4 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-(4-chloro-2-nitrophenyl)-1,3-dimethoxybenzene |
| SMILES | COc1cccc(OC)c1-c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12ClNO4/c1-19-12-4-3-5-13(20-2)14(12)10-7-6-9(15)8-11(10)16(17)18/h3-8H,1-2H3 |
| InChIKey | ZCVAYXHUEIDNKV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|