C17H21N7 — CID 56650738
1-ethyl-4-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)triazol-1-yl]piperidine (PubChem CID 56650738) has the molecular formula C17H21N7 and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-ethyl-4-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)triazol-1-yl]piperidine.
| Compound Name | 1-ethyl-4-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)triazol-1-yl]piperidine |
|---|---|
| PubChem CID | 56650738 |
| Molecular Formula | C17H21N7 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 1-ethyl-4-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)triazol-1-yl]piperidine |
| SMILES | CCN1CCC(n2cc(-c3nc(-c4ccccc4)n[nH]3)nn2)CC1 |
| InChI | InChI=1S/C17H21N7/c1-2-23-10-8-14(9-11-23)24-12-15(19-22-24)17-18-16(20-21-17)13-6-4-3-5-7-13/h3-7,12,14H,2,8-11H2,1H3,(H,18,20,21) |
| InChIKey | HJRNLXGVMIZQOR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |