About 5-hydroxypent-2-ynyl methyl carbonate
5-hydroxypent-2-ynyl methyl carbonate (PubChem CID 56650849) has the molecular formula C7H10O4
and a molecular weight of 158.15 g/mol. Its IUPAC name is 5-hydroxypent-2-ynyl methyl carbonate.
Molecular Properties
| Compound Name | 5-hydroxypent-2-ynyl methyl carbonate |
| PubChem CID | 56650849 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 5-hydroxypent-2-ynyl methyl carbonate |
| SMILES | COC(=O)OCC#CCCO |
| InChI | InChI=1S/C7H10O4/c1-10-7(9)11-6-4-2-3-5-8/h8H,3,5-6H2,1H3 |
| InChIKey | MCYXJDNWDLAJDV-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxypent-2-ynyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxypent-2-ynyl methyl carbonate?
The IUPAC name of 5-hydroxypent-2-ynyl methyl carbonate (CID 56650849) is 5-hydroxypent-2-ynyl methyl carbonate.
What is the SMILES notation for 5-hydroxypent-2-ynyl methyl carbonate?
The canonical SMILES for 5-hydroxypent-2-ynyl methyl carbonate is COC(=O)OCC#CCCO.
What is the InChIKey of 5-hydroxypent-2-ynyl methyl carbonate?
The InChIKey is MCYXJDNWDLAJDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O4/c1-10-7(9)11-6-4-2-3-5-8/h8H,3,5-6H2,1H3.
What are the key properties of 5-hydroxypent-2-ynyl methyl carbonate?
5-hydroxypent-2-ynyl methyl carbonate has a molecular weight of 158.15 g/mol, XLogP of 0.16, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxypent-2-ynyl methyl carbonate is sourced from PubChem (CID 56650849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).