About 3-[5-[(1S,2S)-2-aminocyclopropyl]thiophen-2-yl]phenol
3-[5-[(1S,2S)-2-aminocyclopropyl]thiophen-2-yl]phenol (PubChem CID 56650939) has the molecular formula C13H13NOS
and a molecular weight of 231.32 g/mol. Its IUPAC name is 3-[5-[(1S,2S)-2-aminocyclopropyl]thiophen-2-yl]phenol.
Molecular Properties
| Compound Name | 3-[5-[(1S,2S)-2-aminocyclopropyl]thiophen-2-yl]phenol |
| PubChem CID | 56650939 |
| Molecular Formula | C13H13NOS |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 3-[5-[(1S,2S)-2-aminocyclopropyl]thiophen-2-yl]phenol |
| SMILES | N[C@H]1C[C@@H]1c1ccc(-c2cccc(O)c2)s1 |
| InChI | InChI=1S/C13H13NOS/c14-11-7-10(11)13-5-4-12(16-13)8-2-1-3-9(15)6-8/h1-6,10-11,15H,7,14H2/t10-,11-/m0/s1 |
| InChIKey | KXDUCUANSPMTGM-QWRGUYRKSA-N |
| XLogP | 2.94 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[5-[(1S,2S)-2-aminocyclopropyl]thiophen-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[(1S,2S)-2-aminocyclopropyl]thiophen-2-yl]phenol?
The IUPAC name of 3-[5-[(1S,2S)-2-aminocyclopropyl]thiophen-2-yl]phenol (CID 56650939) is 3-[5-[(1S,2S)-2-aminocyclopropyl]thiophen-2-yl]phenol.
What is the SMILES notation for 3-[5-[(1S,2S)-2-aminocyclopropyl]thiophen-2-yl]phenol?
The canonical SMILES for 3-[5-[(1S,2S)-2-aminocyclopropyl]thiophen-2-yl]phenol is N[C@H]1C[C@@H]1c1ccc(-c2cccc(O)c2)s1.
What is the InChIKey of 3-[5-[(1S,2S)-2-aminocyclopropyl]thiophen-2-yl]phenol?
The InChIKey is KXDUCUANSPMTGM-QWRGUYRKSA-N. The full InChI is InChI=1S/C13H13NOS/c14-11-7-10(11)13-5-4-12(16-13)8-2-1-3-9(15)6-8/h1-6,10-11,15H,7,14H2/t10-,11-/m0/s1.
What are the key properties of 3-[5-[(1S,2S)-2-aminocyclopropyl]thiophen-2-yl]phenol?
3-[5-[(1S,2S)-2-aminocyclopropyl]thiophen-2-yl]phenol has a molecular weight of 231.32 g/mol, XLogP of 2.94, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[(1S,2S)-2-aminocyclopropyl]thiophen-2-yl]phenol is sourced from PubChem (CID 56650939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).