About (1S)-1-[(2S,3R)-3-hydroxyazetidin-2-yl]ethane-1,2-diol
(1S)-1-[(2S,3R)-3-hydroxyazetidin-2-yl]ethane-1,2-diol (PubChem CID 56651208) has the molecular formula C5H11NO3
and a molecular weight of 133.15 g/mol. Its IUPAC name is (1S)-1-[(2S,3R)-3-hydroxyazetidin-2-yl]ethane-1,2-diol.
Molecular Properties
| Compound Name | (1S)-1-[(2S,3R)-3-hydroxyazetidin-2-yl]ethane-1,2-diol |
| PubChem CID | 56651208 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | (1S)-1-[(2S,3R)-3-hydroxyazetidin-2-yl]ethane-1,2-diol |
| SMILES | OC[C@@H](O)[C@H]1NC[C@H]1O |
| InChI | InChI=1S/C5H11NO3/c7-2-4(9)5-3(8)1-6-5/h3-9H,1-2H2/t3-,4-,5+/m1/s1 |
| InChIKey | ZHKBAXKKOKQMPN-WDCZJNDASA-N |
| XLogP | -2.33 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-1-[(2S,3R)-3-hydroxyazetidin-2-yl]ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[(2S,3R)-3-hydroxyazetidin-2-yl]ethane-1,2-diol?
The IUPAC name of (1S)-1-[(2S,3R)-3-hydroxyazetidin-2-yl]ethane-1,2-diol (CID 56651208) is (1S)-1-[(2S,3R)-3-hydroxyazetidin-2-yl]ethane-1,2-diol.
What is the SMILES notation for (1S)-1-[(2S,3R)-3-hydroxyazetidin-2-yl]ethane-1,2-diol?
The canonical SMILES for (1S)-1-[(2S,3R)-3-hydroxyazetidin-2-yl]ethane-1,2-diol is OC[C@@H](O)[C@H]1NC[C@H]1O.
What is the InChIKey of (1S)-1-[(2S,3R)-3-hydroxyazetidin-2-yl]ethane-1,2-diol?
The InChIKey is ZHKBAXKKOKQMPN-WDCZJNDASA-N. The full InChI is InChI=1S/C5H11NO3/c7-2-4(9)5-3(8)1-6-5/h3-9H,1-2H2/t3-,4-,5+/m1/s1.
What are the key properties of (1S)-1-[(2S,3R)-3-hydroxyazetidin-2-yl]ethane-1,2-diol?
(1S)-1-[(2S,3R)-3-hydroxyazetidin-2-yl]ethane-1,2-diol has a molecular weight of 133.15 g/mol, XLogP of -2.33, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[(2S,3R)-3-hydroxyazetidin-2-yl]ethane-1,2-diol is sourced from PubChem (CID 56651208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).