About (9-pentylpyrido[3,4-b]indol-3-yl)-piperidin-1-ylmethanone
(9-pentylpyrido[3,4-b]indol-3-yl)-piperidin-1-ylmethanone (PubChem CID 56651698) has the molecular formula C22H27N3O
and a molecular weight of 349.48 g/mol. Its IUPAC name is (9-pentylpyrido[3,4-b]indol-3-yl)-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | (9-pentylpyrido[3,4-b]indol-3-yl)-piperidin-1-ylmethanone |
| PubChem CID | 56651698 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | (9-pentylpyrido[3,4-b]indol-3-yl)-piperidin-1-ylmethanone |
| SMILES | CCCCCn1c2ccccc2c2cc(C(=O)N3CCCCC3)ncc21 |
| InChI | InChI=1S/C22H27N3O/c1-2-3-7-14-25-20-11-6-5-10-17(20)18-15-19(23-16-21(18)25)22(26)24-12-8-4-9-13-24/h5-6,10-11,15-16H,2-4,7-9,12-14H2,1H3 |
| InChIKey | ALRMJMSWQTWMRV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (9-pentylpyrido[3,4-b]indol-3-yl)-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-pentylpyrido[3,4-b]indol-3-yl)-piperidin-1-ylmethanone?
The IUPAC name of (9-pentylpyrido[3,4-b]indol-3-yl)-piperidin-1-ylmethanone (CID 56651698) is (9-pentylpyrido[3,4-b]indol-3-yl)-piperidin-1-ylmethanone.
What is the SMILES notation for (9-pentylpyrido[3,4-b]indol-3-yl)-piperidin-1-ylmethanone?
The canonical SMILES for (9-pentylpyrido[3,4-b]indol-3-yl)-piperidin-1-ylmethanone is CCCCCn1c2ccccc2c2cc(C(=O)N3CCCCC3)ncc21.
What is the InChIKey of (9-pentylpyrido[3,4-b]indol-3-yl)-piperidin-1-ylmethanone?
The InChIKey is ALRMJMSWQTWMRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3O/c1-2-3-7-14-25-20-11-6-5-10-17(20)18-15-19(23-16-21(18)25)22(26)24-12-8-4-9-13-24/h5-6,10-11,15-16H,2-4,7-9,12-14H2,1H3.
What are the key properties of (9-pentylpyrido[3,4-b]indol-3-yl)-piperidin-1-ylmethanone?
(9-pentylpyrido[3,4-b]indol-3-yl)-piperidin-1-ylmethanone has a molecular weight of 349.48 g/mol, XLogP of 5.01, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9-pentylpyrido[3,4-b]indol-3-yl)-piperidin-1-ylmethanone is sourced from PubChem (CID 56651698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).