C21H22N2O6 — CID 56651997
methyl (3S,7R)-7-methyl-9,12-dioxo-11-phenylmethoxy-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxylate (PubChem CID 56651997) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is methyl (3S,7R)-7-methyl-9,12-dioxo-11-phenylmethoxy-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxylate.
| Compound Name | methyl (3S,7R)-7-methyl-9,12-dioxo-11-phenylmethoxy-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxylate |
|---|---|
| PubChem CID | 56651997 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | methyl (3S,7R)-7-methyl-9,12-dioxo-11-phenylmethoxy-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxylate |
| SMILES | COC(=O)c1cn2c(c(OCc3ccccc3)c1=O)C(=O)N1[C@H](C)CCO[C@H]1C2 |
| InChI | InChI=1S/C21H22N2O6/c1-13-8-9-28-16-11-22-10-15(21(26)27-2)18(24)19(17(22)20(25)23(13)16)29-12-14-6-4-3-5-7-14/h3-7,10,13,16H,8-9,11-12H2,1-2H3/t13-,16+/m1/s1 |
| InChIKey | QZYFFVRJZHFFNN-CJNGLKHVSA-N |
| XLogP | 1.80 |
| TPSA | 87.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |