About 3-[[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole
3-[[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole (PubChem CID 56652454) has the molecular formula C20H21F2N3
and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-[[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole.
Molecular Properties
| Compound Name | 3-[[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole |
| PubChem CID | 56652454 |
| Molecular Formula | C20H21F2N3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 3-[[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole |
| SMILES | Fc1ccc(F)c(CN2CCN(Cc3c[nH]c4ccccc34)CC2)c1 |
| InChI | InChI=1S/C20H21F2N3/c21-17-5-6-19(22)15(11-17)13-24-7-9-25(10-8-24)14-16-12-23-20-4-2-1-3-18(16)20/h1-6,11-12,23H,7-10,13-14H2 |
| InChIKey | QXMZXABRBSZENN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole?
The IUPAC name of 3-[[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole (CID 56652454) is 3-[[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole.
What is the SMILES notation for 3-[[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole?
The canonical SMILES for 3-[[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole is Fc1ccc(F)c(CN2CCN(Cc3c[nH]c4ccccc34)CC2)c1.
What is the InChIKey of 3-[[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole?
The InChIKey is QXMZXABRBSZENN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21F2N3/c21-17-5-6-19(22)15(11-17)13-24-7-9-25(10-8-24)14-16-12-23-20-4-2-1-3-18(16)20/h1-6,11-12,23H,7-10,13-14H2.
What are the key properties of 3-[[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole?
3-[[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole has a molecular weight of 341.41 g/mol, XLogP of 3.76, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-[(2,5-difluorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole is sourced from PubChem (CID 56652454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).