C23H41ClN2O5 — CID 56652534
tert-butyl (2S)-2-[[(2S,3S)-5-chloro-3-methyl-4-methylidene-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-4-methylpentanoate (PubChem CID 56652534) has the molecular formula C23H41ClN2O5 and a molecular weight of 461.04 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S,3S)-5-chloro-3-methyl-4-methylidene-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-4-methylpentanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S,3S)-5-chloro-3-methyl-4-methylidene-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 56652534 |
| Molecular Formula | C23H41ClN2O5 |
| Molecular Weight | 461.04 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S,3S)-5-chloro-3-methyl-4-methylidene-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-4-methylpentanoate |
| SMILES | C=C(C(C)Cl)[C@H](C)[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H](CC(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H41ClN2O5/c1-13(2)12-17(20(28)30-22(6,7)8)25-19(27)18(15(4)14(3)16(5)24)26-21(29)31-23(9,10)11/h13,15-18H,3,12H2,1-2,4-11H3,(H,25,27)(H,26,29)/t15-,16?,17-,18-/m0/s1 |
| InChIKey | IYIIAYXHHHQDPL-CLTRGCNDSA-N |
| XLogP | 4.57 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.04 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|