C12H19N7O6S3 — CID 56652724
(Z)-but-2-enedioic acid;3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide (PubChem CID 56652724) has the molecular formula C12H19N7O6S3 and a molecular weight of 453.53 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide.
| Compound Name | (Z)-but-2-enedioic acid;3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide |
|---|---|
| PubChem CID | 56652724 |
| Molecular Formula | C12H19N7O6S3 |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | (Z)-but-2-enedioic acid;3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide |
| SMILES | NC(N)=Nc1nc(CSCC/C(N)=N/S(N)(=O)=O)cs1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C8H15N7O2S3.C4H4O4/c9-6(15-20(12,16)17)1-2-18-3-5-4-19-8(13-5)14-7(10)11;5-3(6)1-2-4(7)8/h4H,1-3H2,(H2,9,15)(H2,12,16,17)(H4,10,11,13,14);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | VXXSBOCXDVSFOD-BTJKTKAUSA-N |
| XLogP | -1.06 |
| TPSA | 250.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|