C14H14O2 — CID 56652811
deuterio-[2-[(1E,3E,5E)-hepta-1,3,5-trienyl]-6-hydroxyphenyl]methanone (PubChem CID 56652811) has the molecular formula C14H14O2 and a molecular weight of 215.27 g/mol. Its IUPAC name is deuterio-[2-[(1E,3E,5E)-hepta-1,3,5-trienyl]-6-hydroxyphenyl]methanone.
| Compound Name | deuterio-[2-[(1E,3E,5E)-hepta-1,3,5-trienyl]-6-hydroxyphenyl]methanone |
|---|---|
| PubChem CID | 56652811 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | deuterio-[2-[(1E,3E,5E)-hepta-1,3,5-trienyl]-6-hydroxyphenyl]methanone |
| SMILES | [2H]C(=O)c1c(O)cccc1/C=C/C=C/C=C/C |
| InChI | InChI=1S/C14H14O2/c1-2-3-4-5-6-8-12-9-7-10-14(16)13(12)11-15/h2-11,16H,1H3/b3-2+,5-4+,8-6+/i11D |
| InChIKey | RKSMRVQQXHUKLR-PNOCPGRDSA-N |
| XLogP | 3.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|