C28H21F2N5O2 — CID 56653081
1-fluoro-7-(2-fluoro-3-pyridinyl)-3-morpholin-4-ylspiro[chromeno[2,3-c]pyridine-5,3'-isoindole]-1'-amine (PubChem CID 56653081) has the molecular formula C28H21F2N5O2 and a molecular weight of 497.51 g/mol. Its IUPAC name is 1-fluoro-7-(2-fluoro-3-pyridinyl)-3-morpholin-4-ylspiro[chromeno[2,3-c]pyridine-5,3'-isoindole]-1'-amine.
| Compound Name | 1-fluoro-7-(2-fluoro-3-pyridinyl)-3-morpholin-4-ylspiro[chromeno[2,3-c]pyridine-5,3'-isoindole]-1'-amine |
|---|---|
| PubChem CID | 56653081 |
| Molecular Formula | C28H21F2N5O2 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 1-fluoro-7-(2-fluoro-3-pyridinyl)-3-morpholin-4-ylspiro[chromeno[2,3-c]pyridine-5,3'-isoindole]-1'-amine |
| SMILES | NC1=NC2(c3cc(-c4cccnc4F)ccc3Oc3c2cc(N2CCOCC2)nc3F)c2ccccc21 |
| InChI | InChI=1S/C28H21F2N5O2/c29-25-17(5-3-9-32-25)16-7-8-22-20(14-16)28(19-6-2-1-4-18(19)27(31)34-28)21-15-23(33-26(30)24(21)37-22)35-10-12-36-13-11-35/h1-9,14-15H,10-13H2,(H2,31,34) |
| InChIKey | HGYGRYMFKKWEIR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|