About 1-[(E)-1,3-diphenylprop-2-enyl]benzotriazole
1-[(E)-1,3-diphenylprop-2-enyl]benzotriazole (PubChem CID 56653516) has the molecular formula C21H17N3
and a molecular weight of 311.39 g/mol. Its IUPAC name is 1-[(E)-1,3-diphenylprop-2-enyl]benzotriazole.
Molecular Properties
| Compound Name | 1-[(E)-1,3-diphenylprop-2-enyl]benzotriazole |
| PubChem CID | 56653516 |
| Molecular Formula | C21H17N3 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 1-[(E)-1,3-diphenylprop-2-enyl]benzotriazole |
| SMILES | C(=C/C(c1ccccc1)n1nnc2ccccc21)\c1ccccc1 |
| InChI | InChI=1S/C21H17N3/c1-3-9-17(10-4-1)15-16-20(18-11-5-2-6-12-18)24-21-14-8-7-13-19(21)22-23-24/h1-16,20H/b16-15+ |
| InChIKey | XLOJUXOKULUGPA-FOCLMDBBSA-N |
| XLogP | 4.73 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(E)-1,3-diphenylprop-2-enyl]benzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-1,3-diphenylprop-2-enyl]benzotriazole?
The IUPAC name of 1-[(E)-1,3-diphenylprop-2-enyl]benzotriazole (CID 56653516) is 1-[(E)-1,3-diphenylprop-2-enyl]benzotriazole.
What is the SMILES notation for 1-[(E)-1,3-diphenylprop-2-enyl]benzotriazole?
The canonical SMILES for 1-[(E)-1,3-diphenylprop-2-enyl]benzotriazole is C(=C/C(c1ccccc1)n1nnc2ccccc21)\c1ccccc1.
What is the InChIKey of 1-[(E)-1,3-diphenylprop-2-enyl]benzotriazole?
The InChIKey is XLOJUXOKULUGPA-FOCLMDBBSA-N. The full InChI is InChI=1S/C21H17N3/c1-3-9-17(10-4-1)15-16-20(18-11-5-2-6-12-18)24-21-14-8-7-13-19(21)22-23-24/h1-16,20H/b16-15+.
What are the key properties of 1-[(E)-1,3-diphenylprop-2-enyl]benzotriazole?
1-[(E)-1,3-diphenylprop-2-enyl]benzotriazole has a molecular weight of 311.39 g/mol, XLogP of 4.73, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-1,3-diphenylprop-2-enyl]benzotriazole is sourced from PubChem (CID 56653516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).