C13H16O5 — CID 56653562
(1R,2S,6R,7S,9S)-9-hydroxy-9-methyl-11-propan-2-yl-3,5-dioxatricyclo[5.2.2.02,6]undec-10-ene-4,8-dione (PubChem CID 56653562) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is (1R,2S,6R,7S,9S)-9-hydroxy-9-methyl-11-propan-2-yl-3,5-dioxatricyclo[5.2.2.02,6]undec-10-ene-4,8-dione.
| Compound Name | (1R,2S,6R,7S,9S)-9-hydroxy-9-methyl-11-propan-2-yl-3,5-dioxatricyclo[5.2.2.02,6]undec-10-ene-4,8-dione |
|---|---|
| PubChem CID | 56653562 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (1R,2S,6R,7S,9S)-9-hydroxy-9-methyl-11-propan-2-yl-3,5-dioxatricyclo[5.2.2.02,6]undec-10-ene-4,8-dione |
| SMILES | CC(C)C1=C[C@@H]2[C@@H]3OC(=O)O[C@@H]3[C@H]1C(=O)[C@@]2(C)O |
| InChI | InChI=1S/C13H16O5/c1-5(2)6-4-7-9-10(18-12(15)17-9)8(6)11(14)13(7,3)16/h4-5,7-10,16H,1-3H3/t7-,8+,9+,10-,13+/m1/s1 |
| InChIKey | YTPHETKVBADJOP-ASKWGEHWSA-N |
| XLogP | 1.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|