C23H26N6O4 — CID 56653708
5-[[2-[3-(ethylamino)-4,5-dimethylanilino]-5-methylpyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one;formic acid (PubChem CID 56653708) has the molecular formula C23H26N6O4 and a molecular weight of 450.50 g/mol. Its IUPAC name is 5-[[2-[3-(ethylamino)-4,5-dimethylanilino]-5-methylpyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one;formic acid.
| Compound Name | 5-[[2-[3-(ethylamino)-4,5-dimethylanilino]-5-methylpyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one;formic acid |
|---|---|
| PubChem CID | 56653708 |
| Molecular Formula | C23H26N6O4 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 5-[[2-[3-(ethylamino)-4,5-dimethylanilino]-5-methylpyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one;formic acid |
| SMILES | CCNc1cc(Nc2ncc(C)c(Nc3ccc4oc(=O)[nH]c4c3)n2)cc(C)c1C.O=CO |
| InChI | InChI=1S/C22H24N6O2.CH2O2/c1-5-23-17-10-16(8-12(2)14(17)4)26-21-24-11-13(3)20(28-21)25-15-6-7-19-18(9-15)27-22(29)30-19;2-1-3/h6-11,23H,5H2,1-4H3,(H,27,29)(H2,24,25,26,28);1H,(H,2,3) |
| InChIKey | LPJSGIBWNPXPJX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 145.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|