C20H26O8 — CID 56653849
[(1S,3S,4S,5R,6R,8R,9R,10S)-5,9,10-triacetyloxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] acetate (PubChem CID 56653849) has the molecular formula C20H26O8 and a molecular weight of 394.42 g/mol. Its IUPAC name is [(1S,3S,4S,5R,6R,8R,9R,10S)-5,9,10-triacetyloxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] acetate.
| Compound Name | [(1S,3S,4S,5R,6R,8R,9R,10S)-5,9,10-triacetyloxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] acetate |
|---|---|
| PubChem CID | 56653849 |
| Molecular Formula | C20H26O8 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | [(1S,3S,4S,5R,6R,8R,9R,10S)-5,9,10-triacetyloxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H]2C[C@H]1C1C2[C@H]2C[C@@H]1[C@H](OC(C)=O)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C20H26O8/c1-7(21)25-17-11-5-12(18(17)26-8(2)22)16-14-6-13(15(11)16)19(27-9(3)23)20(14)28-10(4)24/h11-20H,5-6H2,1-4H3/t11-,12+,13-,14+,15?,16?,17-,18+,19-,20+ |
| InChIKey | AENIISDHZJVKHR-IZMADWHSSA-N |
| XLogP | 1.25 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|