C29H33FN6O2 — CID 56654101
5-[4-[(4-fluorophenyl)methyl]piperazine-1-carbonyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-2-carboxamide (PubChem CID 56654101) has the molecular formula C29H33FN6O2 and a molecular weight of 516.62 g/mol. Its IUPAC name is 5-[4-[(4-fluorophenyl)methyl]piperazine-1-carbonyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-2-carboxamide.
| Compound Name | 5-[4-[(4-fluorophenyl)methyl]piperazine-1-carbonyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 56654101 |
| Molecular Formula | C29H33FN6O2 |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | 5-[4-[(4-fluorophenyl)methyl]piperazine-1-carbonyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-2-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3ccc(C(=O)N4CCN(Cc5ccc(F)cc5)CC4)cn3)cc2)CC1 |
| InChI | InChI=1S/C29H33FN6O2/c1-33-12-16-35(17-13-33)26-9-7-25(8-10-26)32-28(37)27-11-4-23(20-31-27)29(38)36-18-14-34(15-19-36)21-22-2-5-24(30)6-3-22/h2-11,20H,12-19,21H2,1H3,(H,32,37) |
| InChIKey | QSOJIZDCHOEGLA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|