C12H14Cl2N6 — CID 56654219
6-chloro-4-N-[(6-chloro-3-pyridinyl)methyl]-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine (PubChem CID 56654219) has the molecular formula C12H14Cl2N6 and a molecular weight of 313.19 g/mol. Its IUPAC name is 6-chloro-4-N-[(6-chloro-3-pyridinyl)methyl]-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-[(6-chloro-3-pyridinyl)methyl]-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 56654219 |
| Molecular Formula | C12H14Cl2N6 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 6-chloro-4-N-[(6-chloro-3-pyridinyl)methyl]-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)Nc1nc(Cl)nc(NCc2ccc(Cl)nc2)n1 |
| InChI | InChI=1S/C12H14Cl2N6/c1-7(2)17-12-19-10(14)18-11(20-12)16-6-8-3-4-9(13)15-5-8/h3-5,7H,6H2,1-2H3,(H2,16,17,18,19,20) |
| InChIKey | PWSHWERTQOCDRK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|