About 5-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]thiophene-2-carbonitrile
5-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]thiophene-2-carbonitrile (PubChem CID 56654363) has the molecular formula C13H11N3S
and a molecular weight of 241.32 g/mol. Its IUPAC name is 5-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]thiophene-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]thiophene-2-carbonitrile |
| PubChem CID | 56654363 |
| Molecular Formula | C13H11N3S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 5-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]thiophene-2-carbonitrile |
| SMILES | N#Cc1ccc(-c2ccc([C@H]3C[C@@H]3N)cn2)s1 |
| InChI | InChI=1S/C13H11N3S/c14-6-9-2-4-13(17-9)12-3-1-8(7-16-12)10-5-11(10)15/h1-4,7,10-11H,5,15H2/t10-,11+/m1/s1 |
| InChIKey | WXFIDYNVFUVCJP-MNOVXSKESA-N |
| XLogP | 2.50 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]thiophene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]thiophene-2-carbonitrile?
The IUPAC name of 5-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]thiophene-2-carbonitrile (CID 56654363) is 5-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]thiophene-2-carbonitrile.
What is the SMILES notation for 5-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]thiophene-2-carbonitrile?
The canonical SMILES for 5-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]thiophene-2-carbonitrile is N#Cc1ccc(-c2ccc([C@H]3C[C@@H]3N)cn2)s1.
What is the InChIKey of 5-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]thiophene-2-carbonitrile?
The InChIKey is WXFIDYNVFUVCJP-MNOVXSKESA-N. The full InChI is InChI=1S/C13H11N3S/c14-6-9-2-4-13(17-9)12-3-1-8(7-16-12)10-5-11(10)15/h1-4,7,10-11H,5,15H2/t10-,11+/m1/s1.
What are the key properties of 5-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]thiophene-2-carbonitrile?
5-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]thiophene-2-carbonitrile has a molecular weight of 241.32 g/mol, XLogP of 2.50, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-[(1R,2S)-2-aminocyclopropyl]-2-pyridinyl]thiophene-2-carbonitrile is sourced from PubChem (CID 56654363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).