C22H21N5O3S — CID 56654510
N-[1-(cyanomethylcarbamoyl)cyclohexyl]-4-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)benzamide (PubChem CID 56654510) has the molecular formula C22H21N5O3S and a molecular weight of 435.51 g/mol. Its IUPAC name is N-[1-(cyanomethylcarbamoyl)cyclohexyl]-4-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)benzamide.
| Compound Name | N-[1-(cyanomethylcarbamoyl)cyclohexyl]-4-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)benzamide |
|---|---|
| PubChem CID | 56654510 |
| Molecular Formula | C22H21N5O3S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N-[1-(cyanomethylcarbamoyl)cyclohexyl]-4-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)benzamide |
| SMILES | N#CCNC(=O)C1(NC(=O)c2ccc(-c3noc(-c4cccs4)n3)cc2)CCCCC1 |
| InChI | InChI=1S/C22H21N5O3S/c23-12-13-24-21(29)22(10-2-1-3-11-22)26-19(28)16-8-6-15(7-9-16)18-25-20(30-27-18)17-5-4-14-31-17/h4-9,14H,1-3,10-11,13H2,(H,24,29)(H,26,28) |
| InChIKey | TYGJZXJBFCANQH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|