C28H34F2N4O2 — CID 56654695
3-amino-N-[4-[[5-amino-6-(2,5-difluorophenyl)hexyl]amino]phenyl]-2-hydroxy-4-phenylbutanamide (PubChem CID 56654695) has the molecular formula C28H34F2N4O2 and a molecular weight of 496.60 g/mol. Its IUPAC name is 3-amino-N-[4-[[5-amino-6-(2,5-difluorophenyl)hexyl]amino]phenyl]-2-hydroxy-4-phenylbutanamide.
| Compound Name | 3-amino-N-[4-[[5-amino-6-(2,5-difluorophenyl)hexyl]amino]phenyl]-2-hydroxy-4-phenylbutanamide |
|---|---|
| PubChem CID | 56654695 |
| Molecular Formula | C28H34F2N4O2 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 3-amino-N-[4-[[5-amino-6-(2,5-difluorophenyl)hexyl]amino]phenyl]-2-hydroxy-4-phenylbutanamide |
| SMILES | NC(CCCCNc1ccc(NC(=O)C(O)C(N)Cc2ccccc2)cc1)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C28H34F2N4O2/c29-21-9-14-25(30)20(17-21)18-22(31)8-4-5-15-33-23-10-12-24(13-11-23)34-28(36)27(35)26(32)16-19-6-2-1-3-7-19/h1-3,6-7,9-14,17,22,26-27,33,35H,4-5,8,15-16,18,31-32H2,(H,34,36) |
| InChIKey | BEFDPQKXQPPCCB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|