C29H42F2N4O4 — CID 56654699
tert-butyl N-[6-[2-[(3-amino-2-hydroxy-4-phenylbutanoyl)amino]ethylamino]-1-(2,5-difluorophenyl)hexan-2-yl]carbamate (PubChem CID 56654699) has the molecular formula C29H42F2N4O4 and a molecular weight of 548.68 g/mol. Its IUPAC name is tert-butyl N-[6-[2-[(3-amino-2-hydroxy-4-phenylbutanoyl)amino]ethylamino]-1-(2,5-difluorophenyl)hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[6-[2-[(3-amino-2-hydroxy-4-phenylbutanoyl)amino]ethylamino]-1-(2,5-difluorophenyl)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 56654699 |
| Molecular Formula | C29H42F2N4O4 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | tert-butyl N-[6-[2-[(3-amino-2-hydroxy-4-phenylbutanoyl)amino]ethylamino]-1-(2,5-difluorophenyl)hexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCCCNCCNC(=O)C(O)C(N)Cc1ccccc1)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C29H42F2N4O4/c1-29(2,3)39-28(38)35-23(19-21-18-22(30)12-13-24(21)31)11-7-8-14-33-15-16-34-27(37)26(36)25(32)17-20-9-5-4-6-10-20/h4-6,9-10,12-13,18,23,25-26,33,36H,7-8,11,14-17,19,32H2,1-3H3,(H,34,37)(H,35,38) |
| InChIKey | UQJDHWJGGIBPLK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|