C19H18N2O4 — CID 56654721
3-oxo-6-[(2-phenylmethoxyacetyl)amino]-1,2-dihydroindene-5-carboxamide (PubChem CID 56654721) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 3-oxo-6-[(2-phenylmethoxyacetyl)amino]-1,2-dihydroindene-5-carboxamide.
| Compound Name | 3-oxo-6-[(2-phenylmethoxyacetyl)amino]-1,2-dihydroindene-5-carboxamide |
|---|---|
| PubChem CID | 56654721 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 3-oxo-6-[(2-phenylmethoxyacetyl)amino]-1,2-dihydroindene-5-carboxamide |
| SMILES | NC(=O)c1cc2c(cc1NC(=O)COCc1ccccc1)CCC2=O |
| InChI | InChI=1S/C19H18N2O4/c20-19(24)15-9-14-13(6-7-17(14)22)8-16(15)21-18(23)11-25-10-12-4-2-1-3-5-12/h1-5,8-9H,6-7,10-11H2,(H2,20,24)(H,21,23) |
| InChIKey | OMSGNXAUCOUPAJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |