C25H23NO4 — CID 56654751
(10-hydroxy-1,6,6-trimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-11-yl) pyridine-3-carboxylate (PubChem CID 56654751) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is (10-hydroxy-1,6,6-trimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-11-yl) pyridine-3-carboxylate.
| Compound Name | (10-hydroxy-1,6,6-trimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-11-yl) pyridine-3-carboxylate |
|---|---|
| PubChem CID | 56654751 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (10-hydroxy-1,6,6-trimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-11-yl) pyridine-3-carboxylate |
| SMILES | Cc1coc2c1c(OC(=O)c1cccnc1)c(O)c1c3c(ccc12)C(C)(C)CCC3 |
| InChI | InChI=1S/C25H23NO4/c1-14-13-29-22-17-8-9-18-16(7-4-10-25(18,2)3)20(17)21(27)23(19(14)22)30-24(28)15-6-5-11-26-12-15/h5-6,8-9,11-13,27H,4,7,10H2,1-3H3 |
| InChIKey | GOMWPJUKOSEDMG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|