C27H34O5Si — CID 56655333
[(1R,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-formyloxy-2-methylidenecyclopentyl]methyl 4-phenylbenzoate (PubChem CID 56655333) has the molecular formula C27H34O5Si and a molecular weight of 466.65 g/mol. Its IUPAC name is [(1R,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-formyloxy-2-methylidenecyclopentyl]methyl 4-phenylbenzoate.
| Compound Name | [(1R,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-formyloxy-2-methylidenecyclopentyl]methyl 4-phenylbenzoate |
|---|---|
| PubChem CID | 56655333 |
| Molecular Formula | C27H34O5Si |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | [(1R,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-formyloxy-2-methylidenecyclopentyl]methyl 4-phenylbenzoate |
| SMILES | C=C1[C@H](OC=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H34O5Si/c1-19-23(25(16-24(19)31-18-28)32-33(5,6)27(2,3)4)17-30-26(29)22-14-12-21(13-15-22)20-10-8-7-9-11-20/h7-15,18,23-25H,1,16-17H2,2-6H3/t23-,24+,25-/m0/s1 |
| InChIKey | JVUAACPTIMBFHP-GVAUOCQISA-N |
| XLogP | 6.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|