C22H20F3N7O6 — CID 56655420
5-[[2-[3-(dimethylamino)-4-methylanilino]-5-nitropyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one;2,2,2-trifluoroacetic acid (PubChem CID 56655420) has the molecular formula C22H20F3N7O6 and a molecular weight of 535.44 g/mol. Its IUPAC name is 5-[[2-[3-(dimethylamino)-4-methylanilino]-5-nitropyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[[2-[3-(dimethylamino)-4-methylanilino]-5-nitropyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 56655420 |
| Molecular Formula | C22H20F3N7O6 |
| Molecular Weight | 535.44 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | 5-[[2-[3-(dimethylamino)-4-methylanilino]-5-nitropyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(Nc2ncc([N+](=O)[O-])c(Nc3ccc4oc(=O)[nH]c4c3)n2)cc1N(C)C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H19N7O4.C2HF3O2/c1-11-4-5-13(9-15(11)26(2)3)23-19-21-10-16(27(29)30)18(25-19)22-12-6-7-17-14(8-12)24-20(28)31-17;3-2(4,5)1(6)7/h4-10H,1-3H3,(H,24,28)(H2,21,22,23,25);(H,6,7) |
| InChIKey | YVRYSNGXLGNLFO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 179.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|