C23H28N4O2 — CID 56655930
(E)-2-methyl-N-[3-[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxypropoxy]-6,7-dihydro-5H-quinolin-8-imine (PubChem CID 56655930) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is (E)-2-methyl-N-[3-[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxypropoxy]-6,7-dihydro-5H-quinolin-8-imine.
| Compound Name | (E)-2-methyl-N-[3-[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxypropoxy]-6,7-dihydro-5H-quinolin-8-imine |
|---|---|
| PubChem CID | 56655930 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (E)-2-methyl-N-[3-[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxypropoxy]-6,7-dihydro-5H-quinolin-8-imine |
| SMILES | Cc1ccc2c(n1)/C(=N/OCCCO/N=C1\CCCc3ccc(C)nc31)CCC2 |
| InChI | InChI=1S/C23H28N4O2/c1-16-10-12-18-6-3-8-20(22(18)24-16)26-28-14-5-15-29-27-21-9-4-7-19-13-11-17(2)25-23(19)21/h10-13H,3-9,14-15H2,1-2H3/b26-20+,27-21+ |
| InChIKey | JJGJDEXOWPXTQI-CRYYDKFDSA-N |
| XLogP | 4.30 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|