C29H36N4O2 — CID 56655933
(E)-N-[3-[(E)-2,3,5,6,7,8-hexahydro-1H-acridin-4-ylideneamino]oxypropoxy]-2,3,5,6,7,8-hexahydro-1H-acridin-4-imine (PubChem CID 56655933) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is (E)-N-[3-[(E)-2,3,5,6,7,8-hexahydro-1H-acridin-4-ylideneamino]oxypropoxy]-2,3,5,6,7,8-hexahydro-1H-acridin-4-imine.
| Compound Name | (E)-N-[3-[(E)-2,3,5,6,7,8-hexahydro-1H-acridin-4-ylideneamino]oxypropoxy]-2,3,5,6,7,8-hexahydro-1H-acridin-4-imine |
|---|---|
| PubChem CID | 56655933 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | (E)-N-[3-[(E)-2,3,5,6,7,8-hexahydro-1H-acridin-4-ylideneamino]oxypropoxy]-2,3,5,6,7,8-hexahydro-1H-acridin-4-imine |
| SMILES | c1c2c(nc3c1CCC/C3=N\OCCCO/N=C1\CCCc3cc4c(nc31)CCCC4)CCCC2 |
| InChI | InChI=1S/C29H36N4O2/c1-3-12-24-20(8-1)18-22-10-5-14-26(28(22)30-24)32-34-16-7-17-35-33-27-15-6-11-23-19-21-9-2-4-13-25(21)31-29(23)27/h18-19H,1-17H2/b32-26+,33-27+ |
| InChIKey | YNMGHTNSGOKWOS-RPZUVYPISA-N |
| XLogP | 5.44 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|