C25H30F2N4O2 — CID 56655934
(E)-4-(fluoromethyl)-N-[3-[(E)-[4-(fluoromethyl)-2-methyl-6,7-dihydro-5H-quinolin-8-ylidene]amino]oxypropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine (PubChem CID 56655934) has the molecular formula C25H30F2N4O2 and a molecular weight of 456.54 g/mol. Its IUPAC name is (E)-4-(fluoromethyl)-N-[3-[(E)-[4-(fluoromethyl)-2-methyl-6,7-dihydro-5H-quinolin-8-ylidene]amino]oxypropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine.
| Compound Name | (E)-4-(fluoromethyl)-N-[3-[(E)-[4-(fluoromethyl)-2-methyl-6,7-dihydro-5H-quinolin-8-ylidene]amino]oxypropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine |
|---|---|
| PubChem CID | 56655934 |
| Molecular Formula | C25H30F2N4O2 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | (E)-4-(fluoromethyl)-N-[3-[(E)-[4-(fluoromethyl)-2-methyl-6,7-dihydro-5H-quinolin-8-ylidene]amino]oxypropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine |
| SMILES | Cc1cc(CF)c2c(n1)/C(=N/OCCCO/N=C1\CCCc3c(CF)cc(C)nc31)CCC2 |
| InChI | InChI=1S/C25H30F2N4O2/c1-16-12-18(14-26)20-6-3-8-22(24(20)28-16)30-32-10-5-11-33-31-23-9-4-7-21-19(15-27)13-17(2)29-25(21)23/h12-13H,3-11,14-15H2,1-2H3/b30-22+,31-23+ |
| InChIKey | WQFKQAVWIYDRJZ-WECXDZCISA-N |
| XLogP | 5.24 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|