About 1-[6-(2,6-dimethylphenoxy)-7-fluoro-4-piperidin-1-ylquinazolin-2-yl]pyrazole-4-carboxylic acid
1-[6-(2,6-dimethylphenoxy)-7-fluoro-4-piperidin-1-ylquinazolin-2-yl]pyrazole-4-carboxylic acid (PubChem CID 56655936) has the molecular formula C25H24FN5O3
and a molecular weight of 461.50 g/mol. Its IUPAC name is 1-[6-(2,6-dimethylphenoxy)-7-fluoro-4-piperidin-1-ylquinazolin-2-yl]pyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[6-(2,6-dimethylphenoxy)-7-fluoro-4-piperidin-1-ylquinazolin-2-yl]pyrazole-4-carboxylic acid |
| PubChem CID | 56655936 |
| Molecular Formula | C25H24FN5O3 |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 1-[6-(2,6-dimethylphenoxy)-7-fluoro-4-piperidin-1-ylquinazolin-2-yl]pyrazole-4-carboxylic acid |
| SMILES | Cc1cccc(C)c1Oc1cc2c(N3CCCCC3)nc(-n3cc(C(=O)O)cn3)nc2cc1F |
| InChI | InChI=1S/C25H24FN5O3/c1-15-7-6-8-16(2)22(15)34-21-11-18-20(12-19(21)26)28-25(31-14-17(13-27-31)24(32)33)29-23(18)30-9-4-3-5-10-30/h6-8,11-14H,3-5,9-10H2,1-2H3,(H,32,33) |
| InChIKey | ODSBZMRMEKFJBH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[6-(2,6-dimethylphenoxy)-7-fluoro-4-piperidin-1-ylquinazolin-2-yl]pyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(2,6-dimethylphenoxy)-7-fluoro-4-piperidin-1-ylquinazolin-2-yl]pyrazole-4-carboxylic acid?
The IUPAC name of 1-[6-(2,6-dimethylphenoxy)-7-fluoro-4-piperidin-1-ylquinazolin-2-yl]pyrazole-4-carboxylic acid (CID 56655936) is 1-[6-(2,6-dimethylphenoxy)-7-fluoro-4-piperidin-1-ylquinazolin-2-yl]pyrazole-4-carboxylic acid.
What is the SMILES notation for 1-[6-(2,6-dimethylphenoxy)-7-fluoro-4-piperidin-1-ylquinazolin-2-yl]pyrazole-4-carboxylic acid?
The canonical SMILES for 1-[6-(2,6-dimethylphenoxy)-7-fluoro-4-piperidin-1-ylquinazolin-2-yl]pyrazole-4-carboxylic acid is Cc1cccc(C)c1Oc1cc2c(N3CCCCC3)nc(-n3cc(C(=O)O)cn3)nc2cc1F.
What is the InChIKey of 1-[6-(2,6-dimethylphenoxy)-7-fluoro-4-piperidin-1-ylquinazolin-2-yl]pyrazole-4-carboxylic acid?
The InChIKey is ODSBZMRMEKFJBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24FN5O3/c1-15-7-6-8-16(2)22(15)34-21-11-18-20(12-19(21)26)28-25(31-14-17(13-27-31)24(32)33)29-23(18)30-9-4-3-5-10-30/h6-8,11-14H,3-5,9-10H2,1-2H3,(H,32,33).
What are the key properties of 1-[6-(2,6-dimethylphenoxy)-7-fluoro-4-piperidin-1-ylquinazolin-2-yl]pyrazole-4-carboxylic acid?
1-[6-(2,6-dimethylphenoxy)-7-fluoro-4-piperidin-1-ylquinazolin-2-yl]pyrazole-4-carboxylic acid has a molecular weight of 461.50 g/mol, XLogP of 5.05, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(2,6-dimethylphenoxy)-7-fluoro-4-piperidin-1-ylquinazolin-2-yl]pyrazole-4-carboxylic acid is sourced from PubChem (CID 56655936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).