C23H27N5O2 — CID 56656091
1-(6-cyclohexyl-4-piperidin-1-ylquinazolin-2-yl)pyrazole-4-carboxylic acid (PubChem CID 56656091) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 1-(6-cyclohexyl-4-piperidin-1-ylquinazolin-2-yl)pyrazole-4-carboxylic acid.
| Compound Name | 1-(6-cyclohexyl-4-piperidin-1-ylquinazolin-2-yl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 56656091 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 1-(6-cyclohexyl-4-piperidin-1-ylquinazolin-2-yl)pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnn(-c2nc(N3CCCCC3)c3cc(C4CCCCC4)ccc3n2)c1 |
| InChI | InChI=1S/C23H27N5O2/c29-22(30)18-14-24-28(15-18)23-25-20-10-9-17(16-7-3-1-4-8-16)13-19(20)21(26-23)27-11-5-2-6-12-27/h9-10,13-16H,1-8,11-12H2,(H,29,30) |
| InChIKey | XBLFWPXAWWFYMM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |