C21H19BrF3N7O2 — CID 56656152
2-N-[(E)-(3-bromophenyl)methylideneamino]-6-morpholin-4-yl-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 56656152) has the molecular formula C21H19BrF3N7O2 and a molecular weight of 538.33 g/mol. Its IUPAC name is 2-N-[(E)-(3-bromophenyl)methylideneamino]-6-morpholin-4-yl-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(E)-(3-bromophenyl)methylideneamino]-6-morpholin-4-yl-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 56656152 |
| Molecular Formula | C21H19BrF3N7O2 |
| Molecular Weight | 538.33 g/mol |
| Exact Mass | 537.07 |
| IUPAC Name | 2-N-[(E)-(3-bromophenyl)methylideneamino]-6-morpholin-4-yl-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | FC(F)(F)Oc1ccc(Nc2nc(N/N=C/c3cccc(Br)c3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C21H19BrF3N7O2/c22-15-3-1-2-14(12-15)13-26-31-19-28-18(29-20(30-19)32-8-10-33-11-9-32)27-16-4-6-17(7-5-16)34-21(23,24)25/h1-7,12-13H,8-11H2,(H2,27,28,29,30,31)/b26-13+ |
| InChIKey | PPMLJPVLZVNPGJ-LGJNPRDNSA-N |
| XLogP | 4.56 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|