C31H49N3O4 — CID 56656469
3-[(1R,2S,5S,8S,10R,14R,15S,21R)-1,2,5,8,15,20,20-heptamethyl-13,18-dioxo-19-azapentacyclo[12.9.0.02,11.05,10.015,21]tricos-11-en-8-yl]-1-hydroxy-1-methylurea (PubChem CID 56656469) has the molecular formula C31H49N3O4 and a molecular weight of 527.75 g/mol. Its IUPAC name is 3-[(1R,2S,5S,8S,10R,14R,15S,21R)-1,2,5,8,15,20,20-heptamethyl-13,18-dioxo-19-azapentacyclo[12.9.0.02,11.05,10.015,21]tricos-11-en-8-yl]-1-hydroxy-1-methylurea.
| Compound Name | 3-[(1R,2S,5S,8S,10R,14R,15S,21R)-1,2,5,8,15,20,20-heptamethyl-13,18-dioxo-19-azapentacyclo[12.9.0.02,11.05,10.015,21]tricos-11-en-8-yl]-1-hydroxy-1-methylurea |
|---|---|
| PubChem CID | 56656469 |
| Molecular Formula | C31H49N3O4 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.37 |
| IUPAC Name | 3-[(1R,2S,5S,8S,10R,14R,15S,21R)-1,2,5,8,15,20,20-heptamethyl-13,18-dioxo-19-azapentacyclo[12.9.0.02,11.05,10.015,21]tricos-11-en-8-yl]-1-hydroxy-1-methylurea |
| SMILES | CN(O)C(=O)N[C@@]1(C)CC[C@]2(C)CC[C@]3(C)C(=CC(=O)[C@@H]4[C@@]5(C)CCC(=O)NC(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C31H49N3O4/c1-26(2)22-9-12-31(7)24(29(22,5)11-10-23(36)32-26)21(35)17-19-20-18-28(4,33-25(37)34(8)38)15-13-27(20,3)14-16-30(19,31)6/h17,20,22,24,38H,9-16,18H2,1-8H3,(H,32,36)(H,33,37)/t20-,22-,24+,27+,28-,29-,30+,31+/m0/s1 |
| InChIKey | LHQRJXJBLFFGQE-GJIZTULQSA-N |
| XLogP | 5.62 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|