C26H33FN2O3S — CID 56656540
N-[2-[[2-(azetidin-1-ylmethyl)-3-[(3-fluorophenyl)methyl]-2,3-dihydro-1H-inden-5-yl]oxy]ethyl]cyclobutanesulfonamide (PubChem CID 56656540) has the molecular formula C26H33FN2O3S and a molecular weight of 472.63 g/mol. Its IUPAC name is N-[2-[[2-(azetidin-1-ylmethyl)-3-[(3-fluorophenyl)methyl]-2,3-dihydro-1H-inden-5-yl]oxy]ethyl]cyclobutanesulfonamide.
| Compound Name | N-[2-[[2-(azetidin-1-ylmethyl)-3-[(3-fluorophenyl)methyl]-2,3-dihydro-1H-inden-5-yl]oxy]ethyl]cyclobutanesulfonamide |
|---|---|
| PubChem CID | 56656540 |
| Molecular Formula | C26H33FN2O3S |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | N-[2-[[2-(azetidin-1-ylmethyl)-3-[(3-fluorophenyl)methyl]-2,3-dihydro-1H-inden-5-yl]oxy]ethyl]cyclobutanesulfonamide |
| SMILES | O=S(=O)(NCCOc1ccc2c(c1)C(Cc1cccc(F)c1)C(CN1CCC1)C2)C1CCC1 |
| InChI | InChI=1S/C26H33FN2O3S/c27-22-5-1-4-19(14-22)15-25-21(18-29-11-3-12-29)16-20-8-9-23(17-26(20)25)32-13-10-28-33(30,31)24-6-2-7-24/h1,4-5,8-9,14,17,21,24-25,28H,2-3,6-7,10-13,15-16,18H2 |
| InChIKey | KSOLMCHYOVUWHP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|