C28H28F2N2O6 — CID 56656568
dimethyl (1S,3R,3aS,4aS,5R,7S,7aR,8aR)-3,5-bis(2-fluorophenyl)-1,7-dimethyl-4,8-dioxo-2,3,3a,4a,5,6,7a,8a-octahydropyrrolo[3,4-f]isoindole-1,7-dicarboxylate (PubChem CID 56656568) has the molecular formula C28H28F2N2O6 and a molecular weight of 526.54 g/mol. Its IUPAC name is dimethyl (1S,3R,3aS,4aS,5R,7S,7aR,8aR)-3,5-bis(2-fluorophenyl)-1,7-dimethyl-4,8-dioxo-2,3,3a,4a,5,6,7a,8a-octahydropyrrolo[3,4-f]isoindole-1,7-dicarboxylate.
| Compound Name | dimethyl (1S,3R,3aS,4aS,5R,7S,7aR,8aR)-3,5-bis(2-fluorophenyl)-1,7-dimethyl-4,8-dioxo-2,3,3a,4a,5,6,7a,8a-octahydropyrrolo[3,4-f]isoindole-1,7-dicarboxylate |
|---|---|
| PubChem CID | 56656568 |
| Molecular Formula | C28H28F2N2O6 |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | dimethyl (1S,3R,3aS,4aS,5R,7S,7aR,8aR)-3,5-bis(2-fluorophenyl)-1,7-dimethyl-4,8-dioxo-2,3,3a,4a,5,6,7a,8a-octahydropyrrolo[3,4-f]isoindole-1,7-dicarboxylate |
| SMILES | COC(=O)[C@@]1(C)N[C@@H](c2ccccc2F)[C@H]2C(=O)[C@H]3[C@@H](C(=O)[C@H]21)[C@@](C)(C(=O)OC)N[C@H]3c1ccccc1F |
| InChI | InChI=1S/C28H28F2N2O6/c1-27(25(35)37-3)19-17(21(31-27)13-9-5-7-11-15(13)29)23(33)18-20(24(19)34)28(2,26(36)38-4)32-22(18)14-10-6-8-12-16(14)30/h5-12,17-22,31-32H,1-4H3/t17-,18-,19-,20-,21-,22-,27-,28-/m0/s1 |
| InChIKey | APENIVAPCYLCRD-LMCCOIAISA-N |
| XLogP | 2.43 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |