C28H28F2N2O6 — CID 56656569
dimethyl (1R,3S,3aR,4aR,5S,7R,7aS,8aS)-1,5-bis(3-fluorophenyl)-3,7-dimethyl-4,8-dioxo-1,2,3a,4a,5,6,7a,8a-octahydropyrrolo[3,4-f]isoindole-3,7-dicarboxylate (PubChem CID 56656569) has the molecular formula C28H28F2N2O6 and a molecular weight of 526.54 g/mol. Its IUPAC name is dimethyl (1R,3S,3aR,4aR,5S,7R,7aS,8aS)-1,5-bis(3-fluorophenyl)-3,7-dimethyl-4,8-dioxo-1,2,3a,4a,5,6,7a,8a-octahydropyrrolo[3,4-f]isoindole-3,7-dicarboxylate.
| Compound Name | dimethyl (1R,3S,3aR,4aR,5S,7R,7aS,8aS)-1,5-bis(3-fluorophenyl)-3,7-dimethyl-4,8-dioxo-1,2,3a,4a,5,6,7a,8a-octahydropyrrolo[3,4-f]isoindole-3,7-dicarboxylate |
|---|---|
| PubChem CID | 56656569 |
| Molecular Formula | C28H28F2N2O6 |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | dimethyl (1R,3S,3aR,4aR,5S,7R,7aS,8aS)-1,5-bis(3-fluorophenyl)-3,7-dimethyl-4,8-dioxo-1,2,3a,4a,5,6,7a,8a-octahydropyrrolo[3,4-f]isoindole-3,7-dicarboxylate |
| SMILES | COC(=O)[C@]1(C)N[C@H](c2cccc(F)c2)[C@@H]2C(=O)[C@@H]3[C@H](C(=O)[C@@H]21)[C@H](c1cccc(F)c1)N[C@]3(C)C(=O)OC |
| InChI | InChI=1S/C28H28F2N2O6/c1-27(25(35)37-3)19-17(21(31-27)13-7-5-9-15(29)11-13)24(34)20-18(23(19)33)22(14-8-6-10-16(30)12-14)32-28(20,2)26(36)38-4/h5-12,17-22,31-32H,1-4H3/t17-,18+,19-,20+,21-,22+,27-,28+ |
| InChIKey | XKHHTCNHMVNRPS-RXKLRFCNSA-N |
| XLogP | 2.43 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |