C38H54N6O5 — CID 56657801
(3S,6R,9S,12R)-3-[(2S)-butan-2-yl]-9-(6-oxooctyl)-6-(4-piperidin-1-ylquinolin-3-yl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone (PubChem CID 56657801) has the molecular formula C38H54N6O5 and a molecular weight of 674.89 g/mol. Its IUPAC name is (3S,6R,9S,12R)-3-[(2S)-butan-2-yl]-9-(6-oxooctyl)-6-(4-piperidin-1-ylquinolin-3-yl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6R,9S,12R)-3-[(2S)-butan-2-yl]-9-(6-oxooctyl)-6-(4-piperidin-1-ylquinolin-3-yl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 56657801 |
| Molecular Formula | C38H54N6O5 |
| Molecular Weight | 674.89 g/mol |
| Exact Mass | 674.42 |
| IUPAC Name | (3S,6R,9S,12R)-3-[(2S)-butan-2-yl]-9-(6-oxooctyl)-6-(4-piperidin-1-ylquinolin-3-yl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
| SMILES | CCC(=O)CCCCC[C@@H]1NC(=O)[C@H]2CCCCN2C(=O)[C@H]([C@@H](C)CC)NC(=O)[C@@H](c2cnc3ccccc3c2N2CCCCC2)NC1=O |
| InChI | InChI=1S/C38H54N6O5/c1-4-25(3)32-38(49)44-23-15-12-20-31(44)36(47)40-30(19-9-6-8-16-26(45)5-2)35(46)42-33(37(48)41-32)28-24-39-29-18-11-10-17-27(29)34(28)43-21-13-7-14-22-43/h10-11,17-18,24-25,30-33H,4-9,12-16,19-23H2,1-3H3,(H,40,47)(H,41,48)(H,42,46)/t25-,30-,31+,32-,33+/m0/s1 |
| InChIKey | JPJYOPNEGMWFJL-RVNUKJHSSA-N |
| XLogP | 4.72 |
| TPSA | 140.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.89 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|