C14H10F3N7 — CID 56657920
11-methyl-4-[4-(trifluoromethyl)phenyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine (PubChem CID 56657920) has the molecular formula C14H10F3N7 and a molecular weight of 333.28 g/mol. Its IUPAC name is 11-methyl-4-[4-(trifluoromethyl)phenyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine.
| Compound Name | 11-methyl-4-[4-(trifluoromethyl)phenyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine |
|---|---|
| PubChem CID | 56657920 |
| Molecular Formula | C14H10F3N7 |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 11-methyl-4-[4-(trifluoromethyl)phenyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine |
| SMILES | Cn1cc2c(nc(N)n3nc(-c4ccc(C(F)(F)F)cc4)nc23)n1 |
| InChI | InChI=1S/C14H10F3N7/c1-23-6-9-11(21-23)20-13(18)24-12(9)19-10(22-24)7-2-4-8(5-3-7)14(15,16)17/h2-6H,1H3,(H2,18,20,21) |
| InChIKey | KDGPRHWWBZBOLO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |