C26H25N3O3 — CID 56657922
N-(1,3-benzodioxol-5-ylmethyl)-N'-(7-phenoxyquinolin-4-yl)propane-1,3-diamine (PubChem CID 56657922) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-(7-phenoxyquinolin-4-yl)propane-1,3-diamine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-(7-phenoxyquinolin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 56657922 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-(7-phenoxyquinolin-4-yl)propane-1,3-diamine |
| SMILES | c1ccc(Oc2ccc3c(NCCCNCc4ccc5c(c4)OCO5)ccnc3c2)cc1 |
| InChI | InChI=1S/C26H25N3O3/c1-2-5-20(6-3-1)32-21-8-9-22-23(11-14-29-24(22)16-21)28-13-4-12-27-17-19-7-10-25-26(15-19)31-18-30-25/h1-3,5-11,14-16,27H,4,12-13,17-18H2,(H,28,29) |
| InChIKey | IEMBQFCUMBJOEI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 64.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|