About methyl 2-[(2S,6S)-2-(hydroxymethyl)-6-methoxymorpholin-4-yl]-3-phenylpropanoate
methyl 2-[(2S,6S)-2-(hydroxymethyl)-6-methoxymorpholin-4-yl]-3-phenylpropanoate (PubChem CID 56657934) has the molecular formula C16H23NO5
and a molecular weight of 309.36 g/mol. Its IUPAC name is methyl 2-[(2S,6S)-2-(hydroxymethyl)-6-methoxymorpholin-4-yl]-3-phenylpropanoate.
Molecular Properties
| Compound Name | methyl 2-[(2S,6S)-2-(hydroxymethyl)-6-methoxymorpholin-4-yl]-3-phenylpropanoate |
| PubChem CID | 56657934 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | methyl 2-[(2S,6S)-2-(hydroxymethyl)-6-methoxymorpholin-4-yl]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)N1C[C@@H](CO)O[C@H](OC)C1 |
| InChI | InChI=1S/C16H23NO5/c1-20-15-10-17(9-13(11-18)22-15)14(16(19)21-2)8-12-6-4-3-5-7-12/h3-7,13-15,18H,8-11H2,1-2H3/t13-,14?,15-/m0/s1 |
| InChIKey | UUJXYYVBGKIOGU-LWEDLAQUSA-N |
| XLogP | 0.44 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[(2S,6S)-2-(hydroxymethyl)-6-methoxymorpholin-4-yl]-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2S,6S)-2-(hydroxymethyl)-6-methoxymorpholin-4-yl]-3-phenylpropanoate?
The IUPAC name of methyl 2-[(2S,6S)-2-(hydroxymethyl)-6-methoxymorpholin-4-yl]-3-phenylpropanoate (CID 56657934) is methyl 2-[(2S,6S)-2-(hydroxymethyl)-6-methoxymorpholin-4-yl]-3-phenylpropanoate.
What is the SMILES notation for methyl 2-[(2S,6S)-2-(hydroxymethyl)-6-methoxymorpholin-4-yl]-3-phenylpropanoate?
The canonical SMILES for methyl 2-[(2S,6S)-2-(hydroxymethyl)-6-methoxymorpholin-4-yl]-3-phenylpropanoate is COC(=O)C(Cc1ccccc1)N1C[C@@H](CO)O[C@H](OC)C1.
What is the InChIKey of methyl 2-[(2S,6S)-2-(hydroxymethyl)-6-methoxymorpholin-4-yl]-3-phenylpropanoate?
The InChIKey is UUJXYYVBGKIOGU-LWEDLAQUSA-N. The full InChI is InChI=1S/C16H23NO5/c1-20-15-10-17(9-13(11-18)22-15)14(16(19)21-2)8-12-6-4-3-5-7-12/h3-7,13-15,18H,8-11H2,1-2H3/t13-,14?,15-/m0/s1.
What are the key properties of methyl 2-[(2S,6S)-2-(hydroxymethyl)-6-methoxymorpholin-4-yl]-3-phenylpropanoate?
methyl 2-[(2S,6S)-2-(hydroxymethyl)-6-methoxymorpholin-4-yl]-3-phenylpropanoate has a molecular weight of 309.36 g/mol, XLogP of 0.44, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2S,6S)-2-(hydroxymethyl)-6-methoxymorpholin-4-yl]-3-phenylpropanoate is sourced from PubChem (CID 56657934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).