C19H25N3O4 — CID 56658086
N-hydroxy-N'-(1-methoxypropan-2-yl)-2-(2-propan-2-yloxyphenoxy)pyridine-3-carboximidamide (PubChem CID 56658086) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-hydroxy-N'-(1-methoxypropan-2-yl)-2-(2-propan-2-yloxyphenoxy)pyridine-3-carboximidamide.
| Compound Name | N-hydroxy-N'-(1-methoxypropan-2-yl)-2-(2-propan-2-yloxyphenoxy)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56658086 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-hydroxy-N'-(1-methoxypropan-2-yl)-2-(2-propan-2-yloxyphenoxy)pyridine-3-carboximidamide |
| SMILES | COCC(C)/N=C(\NO)c1cccnc1Oc1ccccc1OC(C)C |
| InChI | InChI=1S/C19H25N3O4/c1-13(2)25-16-9-5-6-10-17(16)26-19-15(8-7-11-20-19)18(22-23)21-14(3)12-24-4/h5-11,13-14,23H,12H2,1-4H3,(H,21,22) |
| InChIKey | KSRZVDGKDJZJQH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|